(10-bromoanthracen-9-yl)-bis(2,4,6-trimethylphenyl)borane
Modify Date: 2025-10-05 11:11:28
(10-bromoanthracen-9-yl)-bis(2,4,6-trimethylphenyl)borane structure
|
Common Name | (10-bromoanthracen-9-yl)-bis(2,4,6-trimethylphenyl)borane | ||
|---|---|---|---|---|
| CAS Number | 191534-39-1 | Molecular Weight | 505.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H30BBr | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (10-bromoanthracen-9-yl)-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H30BBr |
|---|---|
| Molecular Weight | 505.29600 |
| Exact Mass | 504.16200 |
| LogP | 7.12210 |
| InChIKey | DHLIMYDVQCYRMW-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)c2c3ccccc3c(Br)c3ccccc23)c(C)c1 |
|
~72%
(10-bromoanthra... CAS#:191534-39-1 |
| Literature: Yamaguchi, Shigehiro; Akiyama, Seiji; Tamao, Kohei Journal of the American Chemical Society, 2000 , vol. 122, # 26 p. 6335 - 6336 |
| 9-(dimesitylboryl)-10-bromoanthracene |
| Borane,(10-bromo-9-anthracenyl)bis(2,4,6-trimethylphenyl) |
| 9-bromo-10-(dimesitylboryl)anthracene |