dimesitylboronfluoride structure
|
Common Name | dimesitylboronfluoride | ||
|---|---|---|---|---|
| CAS Number | 436-59-9 | Molecular Weight | 268.177 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 364.2±52.0 °C at 760 mmHg | |
| Molecular Formula | C18H22BF | Melting Point | 69-72ºC(lit.) | |
| MSDS | N/A | Flash Point | 174.1±30.7 °C | |
| Name | fluoro-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 364.2±52.0 °C at 760 mmHg |
| Melting Point | 69-72ºC(lit.) |
| Molecular Formula | C18H22BF |
| Molecular Weight | 268.177 |
| Flash Point | 174.1±30.7 °C |
| Exact Mass | 268.179871 |
| LogP | 7.11 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | WZWGERGANZMXOM-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(B(F)c2c(C)cc(C)cc2C)c(C)c1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| Packaging Group | III |
| HS Code | 2931900090 |
|
~67%
dimesitylboronf... CAS#:436-59-9 |
| Literature: Eisch, John J.; Shafii, Babak; Odom, Jerome D.; Rheingold, Arnold L. Journal of the American Chemical Society, 1990 , vol. 112, # 5 p. 1847 - 1853 |
|
~%
dimesitylboronf... CAS#:436-59-9 |
| Literature: Brown; Dodson Journal of the American Chemical Society, 1957 , vol. 79, p. 2302,2304 |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| FB(2,4,6-Me3C6H2)2 |
| bis-mesitylfluroborane |
| fluorodimesitylborane |
| Dimesitylfluoroborane |
| Fluoro(dimesityl)borane |
| dimesitylboronfluoride |
| Dimesitylboron fluoride |
| MFCD00012203 |