2(3H)-Furanone,5-[(3,4-dihydroxyphenyl)methyl]dihydro-,(5R)-(9CI) structure
|
Common Name | 2(3H)-Furanone,5-[(3,4-dihydroxyphenyl)methyl]dihydro-,(5R)-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 191666-22-5 | Molecular Weight | 208.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5R)-5-(3,4-Dihydroxybenzyl)dihydro-2(3H)-furanone |
|---|
| Molecular Formula | C11H12O4 |
|---|---|
| Molecular Weight | 208.21100 |
| Exact Mass | 208.07400 |
| PSA | 66.76000 |
| LogP | 1.34590 |
| InChIKey | ZNXXWTPQHVLMQT-MRVPVSSYSA-N |
| SMILES | O=C1CCC(Cc2ccc(O)c(O)c2)O1 |
|
~87%
2(3H)-Furanone,... CAS#:191666-22-5 |
| Literature: Hamada, Masahiro; Furuno, Ai; Nakano, Sousuke; Kishimoto, Takao; Nakajima, Noriyuki Synthesis, 2010 , # 9 art. no. F23809SS, p. 1512 - 1520 |
|
~%
Detail
|
| Literature: Meselhy, Meselhy R.; Nakamura, Norio; Hattori, Masao Chemical and Pharmaceutical Bulletin, 1997 , vol. 45, # 5 p. 888 - 893 |
|
~%
Detail
|
| Literature: Meselhy, Meselhy R.; Nakamura, Norio; Hattori, Masao Chemical and Pharmaceutical Bulletin, 1997 , vol. 45, # 5 p. 888 - 893 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |