Urea,N-phenyl-N'-(2,2,2-trichloro-1-hydroxyethyl)- structure
|
Common Name | Urea,N-phenyl-N'-(2,2,2-trichloro-1-hydroxyethyl)- | ||
|---|---|---|---|---|
| CAS Number | 19177-72-1 | Molecular Weight | 283.53900 | |
| Density | 1.575g/cm3 | Boiling Point | 353.1ºC at 760mmHg | |
| Molecular Formula | C9H9Cl3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.4ºC | |
| Name | 1-phenyl-3-(2,2,2-trichloro-1-hydroxyethyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.575g/cm3 |
|---|---|
| Boiling Point | 353.1ºC at 760mmHg |
| Molecular Formula | C9H9Cl3N2O2 |
| Molecular Weight | 283.53900 |
| Flash Point | 167.4ºC |
| Exact Mass | 281.97300 |
| PSA | 61.36000 |
| LogP | 2.96060 |
| Vapour Pressure | 1.35E-05mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | VEEYNMFORWXFOZ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)NC(O)C(Cl)(Cl)Cl |
| HS Code | 2924299090 |
|---|
|
~73%
Urea,N-phenyl-N... CAS#:19177-72-1 |
| Literature: Ishai, D. Ben; Sataty, I.; Peled, N.; Goldshare, R. Tetrahedron, 1987 , vol. 43, # 2 p. 439 - 450 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Phenyl-N'-(2,2,2-trichlor-1-hydroxy-aethyl)-harnstoff |
| N-phenyl-N'-(2,2,2-trichloro-1-hydroxy-ethyl)-urea |
| EINECS 242-857-5 |
| N-Phenyl-N'-<2.2.2-trichlor-1-hydroxy-ethyl>-harnstoff |