Benzamide,2-hydroxy-N-(2,2,2-trichloro-1-hydroxyethyl) structure
|
Common Name | Benzamide,2-hydroxy-N-(2,2,2-trichloro-1-hydroxyethyl) | ||
|---|---|---|---|---|
| CAS Number | 2674-50-2 | Molecular Weight | 284.52400 | |
| Density | 1.609g/cm3 | Boiling Point | 437.2ºC at 760 mmHg | |
| Molecular Formula | C9H8Cl3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.2ºC | |
| Name | Ethanol, 2,2,2-trichloro-1-salicylamido |
|---|---|
| Synonym | More Synonyms |
| Density | 1.609g/cm3 |
|---|---|
| Boiling Point | 437.2ºC at 760 mmHg |
| Molecular Formula | C9H8Cl3NO3 |
| Molecular Weight | 284.52400 |
| Flash Point | 218.2ºC |
| Exact Mass | 282.95700 |
| PSA | 69.56000 |
| LogP | 2.20150 |
| Vapour Pressure | 2.03E-08mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | IZLCAIJIGYXNAE-UHFFFAOYSA-N |
| SMILES | O=C(NC(O)C(Cl)(Cl)Cl)c1ccccc1O |
|
~%
Benzamide,2-hyd... CAS#:2674-50-2 |
| Literature: Kaufmann Archiv der Pharmazie (Weinheim, Germany), 1927 , p. 237 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
| 9-Cmbib |
| Chloralsalicylamid |