1-HYDRAZINOPROPAN-2-OL structure
|
Common Name | 1-HYDRAZINOPROPAN-2-OL | ||
|---|---|---|---|---|
| CAS Number | 191871-91-7 | Molecular Weight | 236.31000 | |
| Density | 1.089g/cm3 | Boiling Point | 348.9ºC at 760 mmHg | |
| Molecular Formula | C13H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.8ºC | |
| Name | tert-butyl N-[4-(aminomethyl)phenyl]-N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 348.9ºC at 760 mmHg |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31000 |
| Flash Point | 164.8ºC |
| Exact Mass | 236.15200 |
| PSA | 55.56000 |
| LogP | 3.21690 |
| Vapour Pressure | 4.89E-05mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | IGHYTPRPKZWCGC-UHFFFAOYSA-N |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccc(CN)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| I05-2408 |
| tert-Butyl 4-(aminomethyl)phenyl(methyl)carbamate |