(Z)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E)-3-oxooct-1-enyl]cyclopentyl]hept-5-enoic acid structure
|
Common Name | (Z)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E)-3-oxooct-1-enyl]cyclopentyl]hept-5-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 191919-01-4 | Molecular Weight | 352.465 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 535.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.5±26.6 °C | |
Use of (Z)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E)-3-oxooct-1-enyl]cyclopentyl]hept-5-enoic acid8-iso-15-keto Prostaglandin F2α (8-iso-15-keto PGF2α) is a metabolite of the isoprostane 8-iso PGF2α in rabbits, monkeys, and humans. |
| Name | 8-iso-15-keto Prostaglandin F2.α. |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 535.2±50.0 °C at 760 mmHg |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.465 |
| Flash Point | 291.5±26.6 °C |
| Exact Mass | 352.224976 |
| PSA | 94.83000 |
| LogP | 1.84 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | LOLJEILMPWPILA-RLXHZABYSA-N |
| SMILES | CCCCCC(=O)C=CC1C(O)CC(O)C1CC=CCCCC(=O)O |
| Prosta-5,13-dien-1-oic acid, 9,11-dihydroxy-15-oxo-, (5Z,8β,9α,11α,13E)- |
| (5Z,8β,9α,11α,13E)-9,11-Dihydroxy-15-oxoprosta-5,13-dien-1-oic acid |
| 8-iso-15-keto-PGF2alpha |
| (5Z,8b,9a,11a,13E)-9,11-dihydroxy-15-oxo-Prosta-5,13-dien-1-oic acid |