2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene
2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene structure
|
Common Name | 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 192071-13-9 | Molecular Weight | 454.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H27I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: The Chinese name of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene is 2-碘-5-甲基-1,3-双(2,4,6-三甲基苯基)苯，with CAS number 192071-13-9，molecular formula C25H27I，and molecular weight 454.38600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H27I |
|---|---|
| Molecular Weight | 454.38600 |
| Exact Mass | 454.11600 |
| LogP | 7.78400 |
| InChIKey | KQYQLSXFFLOSBG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(-c2cc(C)cc(-c3c(C)cc(C)cc3C)c2I)c(C)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-iodo-5-methyl... CAS#:192071-13-9 |
| Literature: Rigon; Ranaivonjatovo; Escudie Phosphorus, Sulfur and Silicon and Related Elements, 1999 , vol. 152, p. 153 - 167 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-methyl-2,6-bis(2,4,6-trimethylphenyl)iodobenzene |
| 1,1':3',1''-Terphenyl,2'-iodo-2,2'',4,4'',5',6,6''-heptamethyl |
| 2,6-dimesityl-4-methyliodobenzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene? |
| A: LogP of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene is 7.78400. |
| Q: What English synonyms does 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene have? |
| A: English synonyms of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene: 4-methyl-2,6-bis(2,4,6-trimethylphenyl)iodobenzene, 1,1':3',1''-Terphenyl,2'-iodo-2,2'',4,4'',5',6,6''-heptamethyl, 2,6-dimesityl-4-methyliodobenzene. |
| Q: What is the SMILES notation of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene? |
| A: SMILES notation of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene is Cc1cc(C)c(-c2cc(C)cc(-c3c(C)cc(C)cc3C)c2I)c(C)c1. |
| Q: What is the English name of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene? |
| A: The English name of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene is 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene. |
| Q: What is the molecular formula of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene? |
| A: Molecular formula of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene is C25H27I. |
| Q: What is the Chinese name of 192071-13-9? |
| A: Chinese name of 192071-13-9 is 192071-13-9. |
| Q: What is the InChIKey of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene? |
| A: InChIKey of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene is KQYQLSXFFLOSBG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene? |
| A: Molecular weight of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene is 454.38600. |
| Q: What is the CAS number of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene? |
| A: CAS number of 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene is 192071-13-9. |