2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene structure
|
Common Name | 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 192071-13-9 | Molecular Weight | 454.38600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H27I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-iodo-5-methyl-1,3-bis(2,4,6-trimethylphenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H27I |
|---|---|
| Molecular Weight | 454.38600 |
| Exact Mass | 454.11600 |
| LogP | 7.78400 |
| InChIKey | KQYQLSXFFLOSBG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(-c2cc(C)cc(-c3c(C)cc(C)cc3C)c2I)c(C)c1 |
|
~%
2-iodo-5-methyl... CAS#:192071-13-9 |
| Literature: Rigon; Ranaivonjatovo; Escudie Phosphorus, Sulfur and Silicon and Related Elements, 1999 , vol. 152, p. 153 - 167 |
| 4-methyl-2,6-bis(2,4,6-trimethylphenyl)iodobenzene |
| 1,1':3',1''-Terphenyl,2'-iodo-2,2'',4,4'',5',6,6''-heptamethyl |
| 2,6-dimesityl-4-methyliodobenzene |