2,5-bis[(4-dimethylaminophenyl)methylidene]cyclopentan-1-one structure
|
Common Name | 2,5-bis[(4-dimethylaminophenyl)methylidene]cyclopentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 19226-99-4 | Molecular Weight | 346.46500 | |
| Density | 1.167g/cm3 | Boiling Point | 561.7ºC at 760 mmHg | |
| Molecular Formula | C23H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.5ºC | |
| Name | (2E,5E)-2,5-bis[[4-(dimethylamino)phenyl]methylidene]cyclopentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 561.7ºC at 760 mmHg |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.46500 |
| Flash Point | 248.5ºC |
| Exact Mass | 346.20500 |
| PSA | 23.55000 |
| LogP | 4.64850 |
| Vapour Pressure | 1.2E-12mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | GPXHIYXWGUYGHF-MXWIWYRXSA-N |
| SMILES | CN(C)c1ccc(C=C2CCC(=Cc3ccc(N(C)C)cc3)C2=O)cc1 |
|
~96%
2,5-bis[(4-dime... CAS#:19226-99-4 |
| Literature: Katritzky, Alan R.; Fan, Wei-Qiang; Jiao, Xue-Shun; Li, Qiao-Ling Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 1321 - 1325 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,5-bis[4-(dimethylamino)benzylidene]cyclopentanone |
| 2,2'-bis(4-dimethylaminobenzylidene)cyclopentanone |
| 2,5-bis(4-N,N-dimethylaminobenzylidene)cyclopentanone |
| 2,5-Bis-(4-dimethylamino-benzyliden)-cyclopentanon |
| 1.3-Bis-(4-dimethylamino-benzal)-cyclopentanon-(2) |