11α-Hydroxy Canrenone structure
|
Common Name | 11α-Hydroxy Canrenone | ||
|---|---|---|---|---|
| CAS Number | 192569-17-8 | Molecular Weight | 356.455 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 584.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H28O4 | Melting Point | 232-234°C | |
| MSDS | N/A | Flash Point | 207.3±23.6 °C | |
| Name | 11α-Hydroxy Canrenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 584.7±50.0 °C at 760 mmHg |
| Melting Point | 232-234°C |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.455 |
| Flash Point | 207.3±23.6 °C |
| Exact Mass | 356.198761 |
| PSA | 63.60000 |
| LogP | 1.21 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | RJTDWMKVQUPGSY-HYISFEOESA-N |
| SMILES | CC12CCC(=O)C=C1C=CC1C2C(O)CC2(C)C1CCC21CCC(=O)O1 |
| Storage condition | -20?C Freezer |
|
~89%
11α-Hydroxy Can... CAS#:192569-17-8 |
| Literature: G.D. SEARLE and CO. Patent: EP1223174 A2, 2002 ; Location in patent: Example 16 ; |
|
~%
11α-Hydroxy Can... CAS#:192569-17-8 |
| Literature: Chinese Chemical Letters, , vol. 23, # 3 p. 313 - 316 |
| Precursor 1 | |
|---|---|
| DownStream 3 | |
| (8S,9S,10R,11R,13S,14S,17R)-11-Hydroxy-10,13-dimethyl-1,8,9,10,11,12,13,14,15,16-decahydro-3'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-3,5'(2H,4'H)-dione |
| Spiro[17H-cyclopenta[a]phenanthrene-17,2'(5'H)-furan]-3,5'(2H)-dione, 1,3',4',8,9,10,11,12,13,14,15,16-dodecahydro-11-hydroxy-10,13-dimethyl-, (8S,9S,10R,11R,13S,14S,17R)- |
| 11-α-Hydroxycarvenone |
| MFCD09038746 |
| 11a-Hydroxy Canrenone |
| Eplerenone Impurity 9 |