2-[(2-methylphenyl)methyl]butanedioic acid structure
|
Common Name | 2-[(2-methylphenyl)methyl]butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 19263-11-7 | Molecular Weight | 222.23700 | |
| Density | 1.25g/cm3 | Boiling Point | 350.1ºC at 760mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.8ºC | |
| Name | 2-[(2-methylphenyl)methyl]butanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 350.1ºC at 760mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 179.8ºC |
| Exact Mass | 222.08900 |
| PSA | 74.60000 |
| LogP | 1.71300 |
| Vapour Pressure | 1.68E-05mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | WFWVINOHIVDSEV-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1CC(CC(=O)O)C(=O)O |
|
~%
2-[(2-methylphe... CAS#:19263-11-7 |
| Literature: Shechter; Barker Journal of Organic Chemistry, 1956 , vol. 21, p. 1473,1474 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Methylbenzylsuccinic acid |