[2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid
![[2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid Structure](https://image.chemsrc.com/caspic/361/193085-32-4.png)
[2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid structure
|
Common Name | [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid | ||
|---|---|---|---|---|
| CAS Number | 193085-32-4 | Molecular Weight | 247.28800 | |
| Density | 1.106g/cm3 | Boiling Point | 399.881ºC at 760 mmHg | |
| Molecular Formula | C11H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.641ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 399.881ºC at 760 mmHg |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.28800 |
| Flash Point | 195.641ºC |
| Exact Mass | 247.14200 |
| PSA | 88.35000 |
| LogP | 1.59530 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.464 |
| InChIKey | MDTMSMLZHVQGPA-UHFFFAOYSA-N |
| SMILES | CC(C)(COCC(=O)O)NC(=O)OC(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[2-Methyl-2-({[... CAS#:193085-32-4 |
| Literature: NOVO NORDISK A/S Patent: EP1184370 A2, 2002 ; Location in patent: Example 21 ; |
|
~%
[2-Methyl-2-({[... CAS#:193085-32-4 |
| Literature: Peschke, Bernd; Ankersen, Michael; Sehested Hansen, Birgit; Kruse Hansen, Thomas; Langeland Johansen, Nils; Lau, Jesper; Madsen, Kjeld; Petersen, Hans; Thogersen, Henning; Watson, Brett European Journal of Medicinal Chemistry, 1999 , vol. 34, # 5 p. 363 - 380 |
|
~%
[2-Methyl-2-({[... CAS#:193085-32-4 |
| Literature: Peschke, Bernd; Ankersen, Michael; Sehested Hansen, Birgit; Kruse Hansen, Thomas; Langeland Johansen, Nils; Lau, Jesper; Madsen, Kjeld; Petersen, Hans; Thogersen, Henning; Watson, Brett European Journal of Medicinal Chemistry, 1999 , vol. 34, # 5 p. 363 - 380 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2-tert Butoxycarbonylamino-2-methylpropoxy)acetic acid |
| (2-t-Butoxycarbonylamino-2-methylpropoxy)acetic acid |
| <tert-Butoxy-carbonylmethyl>-triphenyl-phosphonium-chlorid |
| (tert-Butoxycarbonylmethyl)triphenylphosphonium chloride |
| (t-butyloxycarbonylmethyl)triphenylphosphonium chloride |
| (2-tert-butoxy-2-oxoethyl)-triphenylphosphonium chloride |
| (t-butoxycarbonylmethyl)-triphenylphosphonium chloride |
| Carbo-tert.-butoxy-methyl-triphenyl-phosphoniumchlorid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid? |
| A: The English name of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid is [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid. |
| Q: What are the upstream materials of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid? |
| A: Related upstream materials(CAS) of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid: 623-73-4;102520-97-8;249762-00-3. |
| Q: What is the SMILES notation of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid? |
| A: SMILES notation of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid is CC(C)(COCC(=O)O)NC(=O)OC(C)(C)C. |
| Q: What is the LogP of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid? |
| A: LogP of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid is 1.59530. |
| Q: What is the polar surface area (PSA) of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid? |
| A: Polar surface area (PSA) of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid is 88.35000. |
| Q: What is the molecular weight of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid? |
| A: Molecular weight of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid is 247.28800. |
| Q: What is the Chinese name of 193085-32-4? |
| A: Chinese name of 193085-32-4 is 193085-32-4. |
| Q: What is the InChIKey of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid? |
| A: InChIKey of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid is MDTMSMLZHVQGPA-UHFFFAOYSA-N. |
| Q: What is the CAS number of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid? |
| A: CAS number of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid is 193085-32-4. |
| Q: What is the boiling point of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid? |
| A: Boiling point of [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid is 399.881ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |