[2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid structure
|
Common Name | [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid | ||
|---|---|---|---|---|
| CAS Number | 193085-32-4 | Molecular Weight | 247.28800 | |
| Density | 1.106g/cm3 | Boiling Point | 399.881ºC at 760 mmHg | |
| Molecular Formula | C11H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.641ºC | |
| Name | [2-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propoxy]ac etic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 399.881ºC at 760 mmHg |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.28800 |
| Flash Point | 195.641ºC |
| Exact Mass | 247.14200 |
| PSA | 88.35000 |
| LogP | 1.59530 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.464 |
| InChIKey | MDTMSMLZHVQGPA-UHFFFAOYSA-N |
| SMILES | CC(C)(COCC(=O)O)NC(=O)OC(C)(C)C |
|
~%
[2-Methyl-2-({[... CAS#:193085-32-4 |
| Literature: NOVO NORDISK A/S Patent: EP1184370 A2, 2002 ; Location in patent: Example 21 ; |
|
~%
[2-Methyl-2-({[... CAS#:193085-32-4 |
| Literature: Peschke, Bernd; Ankersen, Michael; Sehested Hansen, Birgit; Kruse Hansen, Thomas; Langeland Johansen, Nils; Lau, Jesper; Madsen, Kjeld; Petersen, Hans; Thogersen, Henning; Watson, Brett European Journal of Medicinal Chemistry, 1999 , vol. 34, # 5 p. 363 - 380 |
|
~%
[2-Methyl-2-({[... CAS#:193085-32-4 |
| Literature: Peschke, Bernd; Ankersen, Michael; Sehested Hansen, Birgit; Kruse Hansen, Thomas; Langeland Johansen, Nils; Lau, Jesper; Madsen, Kjeld; Petersen, Hans; Thogersen, Henning; Watson, Brett European Journal of Medicinal Chemistry, 1999 , vol. 34, # 5 p. 363 - 380 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (2-tert Butoxycarbonylamino-2-methylpropoxy)acetic acid |
| (2-t-Butoxycarbonylamino-2-methylpropoxy)acetic acid |
| <tert-Butoxy-carbonylmethyl>-triphenyl-phosphonium-chlorid |
| (tert-Butoxycarbonylmethyl)triphenylphosphonium chloride |
| (t-butyloxycarbonylmethyl)triphenylphosphonium chloride |
| (2-tert-butoxy-2-oxoethyl)-triphenylphosphonium chloride |
| (t-butoxycarbonylmethyl)-triphenylphosphonium chloride |
| Carbo-tert.-butoxy-methyl-triphenyl-phosphoniumchlorid |