Zabedosertib structure
|
Common Name | Zabedosertib | ||
|---|---|---|---|---|
| CAS Number | 1931994-81-8 | Molecular Weight | 470.47 | |
| Density | N/A | Boiling Point | 620.7±55.0 °C(Predicted) | |
| Molecular Formula | C20H21F3N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ZabedosertibZabedosertib (BAY 1834845) is a IRAK4 inhibitor with immunomodulatory potential. IRAK4 is a protein kinase involved in signaling innate immune responses from Toll-like receptors[1]. |
| Name | Zabedosertib |
|---|
| Description | Zabedosertib (BAY 1834845) is a IRAK4 inhibitor with immunomodulatory potential. IRAK4 is a protein kinase involved in signaling innate immune responses from Toll-like receptors[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 620.7±55.0 °C(Predicted) |
|---|---|
| Molecular Formula | C20H21F3N4O4S |
| Molecular Weight | 470.47 |
| InChIKey | OQAMEEFUUFJZRS-UHFFFAOYSA-N |
| SMILES | CC(C)(O)c1cc2nn(CCS(C)(=O)=O)cc2cc1NC(=O)c1cccc(C(F)(F)F)n1 |
| Storage condition | 2-8°C |