1,2-Acenaphthylenedione,1,2-dioxime structure
|
Common Name | 1,2-Acenaphthylenedione,1,2-dioxime | ||
|---|---|---|---|---|
| CAS Number | 1932-08-7 | Molecular Weight | 212.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-nitrosoacenaphthylen-1-yl)hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8N2O2 |
|---|---|
| Molecular Weight | 212.20400 |
| Exact Mass | 212.05900 |
| PSA | 65.18000 |
| LogP | 2.21000 |
| Vapour Pressure | 9.69E-09mmHg at 25°C |
| InChIKey | ZBHVKJFVTXXTEQ-XSYHWHKQSA-N |
| SMILES | ON=C1C(=NO)c2cccc3cccc1c23 |
|
~%
1,2-Acenaphthyl... CAS#:1932-08-7 |
| Literature: Rowe; Davies Journal of the Chemical Society, 1920 , vol. 117, p. 1348 |
|
~%
1,2-Acenaphthyl... CAS#:1932-08-7 |
| Literature: Graebe; Gfeller Justus Liebigs Annalen der Chemie, 1893 , vol. 276, p. 15 |
| Acenaphthen-1,2-dion-dioxim |
| MFCD00059513 |
| acenaphthene-1,2-dione dioxime |
| Acanaphthenchinon-dioxim |
| Acetonaphthochinondioxim |
| Acenaphthenequinone Dioxime |
| Acenaphthenchinon-dioxim |
| n-hydroxy-2-nitrosoacenaphthylen-1-amine |