Benzamide,N-methyl-N-phenyl- structure
|
Common Name | Benzamide,N-methyl-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1934-92-5 | Molecular Weight | 211.25900 | |
| Density | 1.13g/cm3 | Boiling Point | 341.3ºC at 760mmHg | |
| Molecular Formula | C14H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.4ºC | |
| Name | N-methyl-N-phenylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 341.3ºC at 760mmHg |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.25900 |
| Flash Point | 154.4ºC |
| Exact Mass | 211.10000 |
| PSA | 20.31000 |
| LogP | 2.96320 |
| Vapour Pressure | 8.12E-05mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | LCOPCEDFGGUYRD-UHFFFAOYSA-N |
| SMILES | CN(C(=O)c1ccccc1)c1ccccc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzamide,N-methyl-N-phenyl |
| N-methylphenyl benzamide |
| N-phenyl-N-methylbenzamide |
| Benzanilide,N-methyl |
| N-methylphenyl-N-benzamide |
| N-METHYLBENZANILIDE |
| N-methyl-N-phenyl-benzamide |
| N-Benzoyl-N-methylaniline |