ethyl 4-(ethylthiocarbamoylamino)benzoate
Modify Date: 2025-10-09 05:59:25
ethyl 4-(ethylthiocarbamoylamino)benzoate structure
|
Common Name | ethyl 4-(ethylthiocarbamoylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 19340-42-2 | Molecular Weight | 252.33300 | |
| Density | 1.2g/cm3 | Boiling Point | 358.7ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.7ºC | |
| Name | ethyl 4-(ethylcarbamothioylamino)benzoate |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 358.7ºC at 760 mmHg |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.33300 |
| Flash Point | 170.7ºC |
| Exact Mass | 252.09300 |
| PSA | 82.45000 |
| LogP | 2.63350 |
| Vapour Pressure | 2.5E-05mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | WIGNKAZCTOXTLY-UHFFFAOYSA-N |
| SMILES | CCNC(=S)Nc1ccc(C(=O)OCC)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
ethyl 4-(ethylt... CAS#:19340-42-2 |
| Literature: Hunter; Parken Journal of the Indian Chemical Society, 1932 , vol. 9, p. 357,359 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |