(E)-N-(4-fluorophenyl)-3-phenyl-prop-2-enamide structure
|
Common Name | (E)-N-(4-fluorophenyl)-3-phenyl-prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 19358-27-1 | Molecular Weight | 241.26000 | |
| Density | 1.233g/cm3 | Boiling Point | 430.8ºC at 760 mmHg | |
| Molecular Formula | C15H12FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.3ºC | |
| Name | N-(4-Fluor-phenyl)-cinnamamid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 430.8ºC at 760 mmHg |
| Molecular Formula | C15H12FNO |
| Molecular Weight | 241.26000 |
| Flash Point | 214.3ºC |
| Exact Mass | 241.09000 |
| PSA | 29.10000 |
| LogP | 3.55060 |
| Vapour Pressure | 1.26E-07mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | FSGUMUYMSDYGOB-IZZDOVSWSA-N |
| SMILES | O=C(C=Cc1ccccc1)Nc1ccc(F)cc1 |
| HS Code | 2924299090 |
|---|
|
~82%
(E)-N-(4-fluoro... CAS#:19358-27-1 |
| Literature: Ueda, Satoshi; Okada, Takahiro; Nagasawa, Hideko Chemical Communications, 2010 , vol. 46, # 14 p. 2462 - 2464 |
|
~82%
(E)-N-(4-fluoro... CAS#:19358-27-1 |
| Literature: Shi, Zhi-Hao; Li, Nian-Guang; Shi, Qian-Ping; Tang, Hao; Tang, Yu-Ping; Li, Wei; Yin, Lian; Yang, Jian-Ping; Duan, Jin-Ao Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 5 p. 1206 - 1211 |
|
~%
(E)-N-(4-fluoro... CAS#:19358-27-1 |
| Literature: Merial Limited; Meng, Charles Q.; Long, Alan; Huber, Scot; Gurrala, Srinivas Reddy; Wilkinson, Douglas Edward; Pacofsky, Gregory Patent: US2014/142114 A1, 2014 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzanilide,4'-fluorothio-(7CI,8CI) |
| N-(4-fluorophenyl)benzo-thioamide |
| Benzenecarbothioamide,N-(4-fluorophenyl) |
| N-(4-fluoro-phenyl)-thiobenzamide |
| N-(4-fluorophenyl)cinnamamide |
| N-(4-fluorophenyl)-3-phenylacrylamide |