Terrestrosin K structure
|
Common Name | Terrestrosin K | ||
|---|---|---|---|---|
| CAS Number | 193605-07-1 | Molecular Weight | 1079.182 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C51H82O24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Terrestrosin KTerrestrosin K, a steroidal saponin from Tribulus terrestris L., has potential to treat cardiovascular and cerebrovascular diseases[1]. |
| Name | Terrestrosin K |
|---|---|
| Synonym | More Synonyms |
| Description | Terrestrosin K, a steroidal saponin from Tribulus terrestris L., has potential to treat cardiovascular and cerebrovascular diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C51H82O24 |
| Molecular Weight | 1079.182 |
| Exact Mass | 1078.519653 |
| LogP | -1.91 |
| Index of Refraction | 1.644 |
| InChIKey | TVRRDUXJKROMDX-UHFFFAOYSA-N |
| SMILES | CC1=C(CCC(C)COC2OC(CO)C(O)C(O)C2O)OC2CC3C4CCC5CC(OC6OC(CO)C(OC7OC(CO)C(O)C(O)C7OC7OC(CO)C(O)C(O)C7O)C(O)C6O)CCC5(C)C4CC(=O)C3(C)C12 |
| Furost-20(22)-en-12-one, 3-[[O-β-D-galactopyranosyl-(1->2)-O-β-D-glucopyranosyl-(1->4)-β-D-galactopyranosyl]oxy]-26-(β-D-glucopyranosyloxy)-, (3β,5α,25R)- |
| (3β,5α,25R)-26-(β-D-Glucopyranosyloxy)-12-oxofurost-20(22)-en-3-yl β-D-galactopyranosyl-(1->2)-β-D-glucopyranosyl-(1->4)-β-D-galactopyranoside |