tert-Butyl 4-(5-nitropyridin-2-yl)piperazine-1-carboxylate structure
|
Common Name | tert-Butyl 4-(5-nitropyridin-2-yl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 193902-78-2 | Molecular Weight | 308.333 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 468.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H20N4O4 | Melting Point | 168-172ºC(lit.) | |
| MSDS | USA | Flash Point | 237.3±28.7 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | tert-butyl 4-(5-nitropyridin-2-yl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 468.7±45.0 °C at 760 mmHg |
| Melting Point | 168-172ºC(lit.) |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.333 |
| Flash Point | 237.3±28.7 °C |
| Exact Mass | 308.148468 |
| PSA | 91.49000 |
| LogP | 1.90 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | WWFJYZONBJARJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc([N+](=O)[O-])cn2)CC1 |
| Storage condition | 2-8°C |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H319 |
| Precautionary Statements | P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R25 |
| Safety Phrases | 45 |
| RIDADR | UN 2811 6.1/PG 3 |
| Hazard Class | 6.1 |
| HS Code | 2933990090 |
|
~90%
tert-Butyl 4-(5... CAS#:193902-78-2 |
| Literature: WARNER-LAMBERT COMPANY, LLC Patent: US2005/182078 A1, 2005 ; Location in patent: Page/Page column 9; 12 ; US 20050182078 A1 |
|
~98%
tert-Butyl 4-(5... CAS#:193902-78-2 |
| Literature: Ting, Pauline C.; Lee, Joe F.; Zorn, Nicolas; Kim, Hyunjin M.; Aslanian, Robert G.; Lin, Mingxiang; Smith, Michelle; Walker, Scott S.; Cook, John; Van Heek, Margaret; Lachowicz, Jean Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 4 p. 985 - 988 |
|
~97%
tert-Butyl 4-(5... CAS#:193902-78-2 |
| Literature: Liu, Yu; Liu, Zining; Cao, Xufeng; Liu, Xin; He, Huili; Yang, Yushe Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 16 p. 4779 - 4783 |
| Precursor 5 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-Butyl 4-(5-nitropyridin-2-yl)piperazine-1-carboxylate |
| 1-tert-Butoxycarbonyl-4-(5-nitropyrid-2-yl)piperazine |
| 2-Methyl-2-propanyl 4-(5-nitro-2-pyridinyl)-1-piperazinecarboxylate |
| t-butyl 4-(5-nitropyridin-2-yl)piperazine-1-carboxylate |
| 1-(terbutyloxycarbonyl)-4-(5-nitro-pyridin-2-yl)-piperazine |
| tert-butyl 4-(5-nitro-2-pyridinyl)-1-piperazinecarboxylate |
| 2-(4-Boc-1-piperazinyl)-5-nitropyridine |
| 1-Piperazinecarboxylic acid, 4-(5-nitro-2-pyridinyl)-, 1,1-dimethylethyl ester |
| 4-(5-nitro-pyridin-2-yl)-piperazine-1-carboxylic acid tert-butyl ester |
| 1,1-dimethylethyl 4-(5-nitro-2-pyridinyl)-1-piperazinecarboxylate |
| 1-Boc-4-(5-nitro-2-pyridyl)piperazine |