5-(4-fluoroanilino)-5-oxopentanoic acid structure
|
Common Name | 5-(4-fluoroanilino)-5-oxopentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 193952-11-3 | Molecular Weight | 225.21600 | |
| Density | 1.318g/cm3 | Boiling Point | 474.1ºC at 760 mmHg | |
| Molecular Formula | C11H12FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.5ºC | |
| Name | 5-(4-fluoroanilino)-5-oxopentanoic acid |
|---|
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 474.1ºC at 760 mmHg |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.21600 |
| Flash Point | 240.5ºC |
| Exact Mass | 225.08000 |
| PSA | 66.40000 |
| LogP | 2.09210 |
| Vapour Pressure | 8.55E-10mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | BBDJNGOBAANARV-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCC(=O)Nc1ccc(F)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |