5-(4-Fluorophenyl)-5-oxopentanoic acid structure
|
Common Name | 5-(4-Fluorophenyl)-5-oxopentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 149437-76-3 | Molecular Weight | 210.202 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 394.6±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H11FO3 | Melting Point | 142-144°C | |
| MSDS | N/A | Flash Point | 192.5±22.3 °C | |
| Name | 4-(4-Fluorobenzoyl)Butyric Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.6±22.0 °C at 760 mmHg |
| Melting Point | 142-144°C |
| Molecular Formula | C11H11FO3 |
| Molecular Weight | 210.202 |
| Flash Point | 192.5±22.3 °C |
| Exact Mass | 210.069229 |
| PSA | 54.37000 |
| LogP | 1.54 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | ZBQROUOOMAMCQW-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCC(=O)c1ccc(F)cc1 |
|
~87%
5-(4-Fluorophen... CAS#:149437-76-3 |
| Literature: RANBAXY LABORATORIES LIMITED Patent: WO2004/99132 A2, 2004 ; Location in patent: Page 7-8 ; |
|
~80%
5-(4-Fluorophen... CAS#:149437-76-3 |
| Literature: Schering Corporation Patent: US6207822 B1, 2001 ; |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(4-Fluorobenzoyl)butyric acid |
| 5-(4-FLUORO-PHENYL)-5-OXO-PENTANOIC ACID |
| MFCD03788503 |
| 5-(4-Fluorophenyl)-5-oxovaleric Acid |
| Benzenepentanoic acid, 4-fluoro-δ-oxo- |
| benzenepentanoic acid, 4-fluoro-d-oxo- |
| 5-(4-Fluorophenyl)-5-oxopentanoic acid |