Cedrelopsin structure
|
Common Name | Cedrelopsin | ||
|---|---|---|---|---|
| CAS Number | 19397-28-5 | Molecular Weight | 260.285 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 457.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.7±22.2 °C | |
Use of CedrelopsinCedrelopsin is a natural phenylpropanoid compound[1]. |
| Name | 7-hydroxy-6-methoxy-8-(3-methylbut-2-en-1-yl)-2H-chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Cedrelopsin is a natural phenylpropanoid compound[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 457.6±45.0 °C at 760 mmHg |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.285 |
| Flash Point | 172.7±22.2 °C |
| Exact Mass | 260.104858 |
| PSA | 59.67000 |
| LogP | 3.38 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | IIEIJMSDKBAFFP-UHFFFAOYSA-N |
| SMILES | COc1cc2ccc(=O)oc2c(CC=C(C)C)c1O |
| Hazard Codes | Xi |
|---|
| 2H-1-Benzopyran-2-one, 7-hydroxy-6-methoxy-8-(3-methyl-2-buten-1-yl)- |
| 7-Hydroxy-6-methoxy-8-(3-methyl-2-buten-1-yl)-2H-chromen-2-one |