4-Fluoro-5-isoquinolinesulfonyl chloride structure
|
Common Name | 4-Fluoro-5-isoquinolinesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 194032-33-2 | Molecular Weight | 245.658 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 360.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C9H5ClFNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.8±23.7 °C | |
| Name | 4-Fluoroisoquinoline-5-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.5±27.0 °C at 760 mmHg |
| Molecular Formula | C9H5ClFNO2S |
| Molecular Weight | 245.658 |
| Flash Point | 171.8±23.7 °C |
| Exact Mass | 244.971359 |
| PSA | 55.41000 |
| LogP | 1.77 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | UZUCKWMDQGESLP-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cccc2cncc(F)c12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
|
~%
4-Fluoro-5-isoq... CAS#:194032-33-2 |
| Literature: Hidaka, Hiroyoshi Patent: EP1074545 A1, 2001 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Isoquinolinesulfonyl chloride, 4-fluoro- |
| 5-chlorosulfonyl-4-fluoroisoquinoline |
| 5-Isoquinolinesulfonyl chloride,4-fluoro |
| 4-Fluoro-5-isoquinolinesulfonyl chloride |
| 4-FLUORO-ISOQUINOLINE-5-SULFONYL CHLORIDE HYDROCHLORIDE |