tert-butyl 5-methyl-1,4-diazepane-1-carboxylate structure
|
Common Name | tert-butyl 5-methyl-1,4-diazepane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 194032-42-3 | Molecular Weight | 214.305 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 288.3±23.0 °C at 760 mmHg | |
| Molecular Formula | C11H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.2±22.6 °C | |
| Name | tert-butyl 5-methyl-1,4-diazepane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 288.3±23.0 °C at 760 mmHg |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.305 |
| Flash Point | 128.2±22.6 °C |
| Exact Mass | 214.168121 |
| PSA | 41.57000 |
| LogP | 1.43 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.457 |
| InChIKey | SVMXIQUBNSPVCB-UHFFFAOYSA-N |
| SMILES | CC1CCN(C(=O)OC(C)(C)C)CCN1 |
| HS Code | 2933990090 |
|---|
|
~17%
tert-butyl 5-me... CAS#:194032-42-3 |
| Literature: Proximagen Limited; Savory, Edward Daniel; Stewart, Allson; Cartey, Allison; Brown, Giles; Simpson, Iain; Oliver, Kathryn; Patient, Lee; Higginbottom, Michael; Cole, Andrew Graham Patent: US2013/289020 A1, 2013 ; Location in patent: Paragraph 0213; 0214 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-1,4-Diazepine-1-carboxylic acid, hexahydro-5-methyl-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 5-methyl-1,4-diazepane-1-carboxylate |
| tetrt-butyl 5-methyl-1,4-diazepane-1-carboxylate |
| 1-Boc-5-Methyl-1,4-diazepane |
| 1H-1,4-Diazepine-1-carboxylic acid,hexahydro-5-methyl-,1,1-dimethylethyl ester |
| tert-butyl 5-methyl-1,4-diazepane-1-carboxylate |