tert-Butyl 5-phenyl-1,4-diazepane-1-carboxylate structure
|
Common Name | tert-Butyl 5-phenyl-1,4-diazepane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 941712-23-8 | Molecular Weight | 276.37400 | |
| Density | 1.052g/cm3 | Boiling Point | 387.4ºC at 760 mmHg | |
| Molecular Formula | C16H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.1ºC | |
| Name | 2,2,3,3-tetratert-butyl-5-phenyl-1,4-diazepane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.052g/cm3 |
|---|---|
| Boiling Point | 387.4ºC at 760 mmHg |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.37400 |
| Flash Point | 188.1ºC |
| Exact Mass | 276.18400 |
| PSA | 41.57000 |
| LogP | 3.22480 |
| Index of Refraction | 1.515 |
| InChIKey | IIRVMCYNJGBVJV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(c2ccccc2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tetrtert-butyl5-phenyl-1,4-diazepane-1-carboxylate |
| tetrt-butyl5-phenyl-1,4-diazepane-1-carboxylate |