isohyenanchin structure
|
Common Name | isohyenanchin | ||
|---|---|---|---|---|
| CAS Number | 19417-00-6 | Molecular Weight | 312.315 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 594.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H20O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.4±23.6 °C | |
Use of isohyenanchinIsohyenanchin (Hydroxycoriatin) is an RDLac homo-oligomers antagonist. Isohyenanchin also is a weak antagonist of ionotropic GABA receptors[1]. |
| Name | (2R,3S,5R,6R,7R,8R)-2,8-Dihydroxy-12-(2-hydroxy-2-propanyl)-7-methyl-11H-spiro[4,10-dioxatetracyclo[7.2.1.02,7.03,5]dodecane-6,2'-oxiran]-11-one |
|---|---|
| Synonym | More Synonyms |
| Description | Isohyenanchin (Hydroxycoriatin) is an RDLac homo-oligomers antagonist. Isohyenanchin also is a weak antagonist of ionotropic GABA receptors[1]. |
|---|---|
| Related Catalog | |
| Target |
RDLac homo-oligomers[1] |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 594.6±50.0 °C at 760 mmHg |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.315 |
| Flash Point | 227.4±23.6 °C |
| Exact Mass | 312.120911 |
| PSA | 112.05000 |
| LogP | 0.45 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | IZLYIEOSKVYJIP-QEOJBFHESA-N |
| SMILES | CC(C)(O)C1C2OC(=O)C1C1(O)C3OC3C3(CO3)C1(C)C2O |
| Hazard Codes | Xi |
|---|
| hydroxycobalamin |
| ohb12 |
| vitamin B12a |
| duradoce |
| (1S,2R,3S,5R,6R,7R,8S,9R,12S)-2,8-Dihydroxy-12-(2-hydroxy-2-propanyl)-7-methyl-11H-spiro[4,10-dioxatetracyclo[7.2.1.0.0]dodecane-6,2'-oxiran]-11-one |
| cobalex |
| docevita |
| docclan |
| hydroxycobalamine |
| vibeden |
| docelan |
| hydroxycoriatin |
| hydrovit |
| axlon |
| axion |
| Isohyenanchin |
| Isoienancin |