[2-hydroxy-5-(trifluoromethyl)phenyl]thiourea structure
|
Common Name | [2-hydroxy-5-(trifluoromethyl)phenyl]thiourea | ||
|---|---|---|---|---|
| CAS Number | 19420-46-3 | Molecular Weight | 236.21400 | |
| Density | 1.58g/cm3 | Boiling Point | 307.3ºC at 760 mmHg | |
| Molecular Formula | C8H7F3N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.7ºC | |
| Name | [2-hydroxy-5-(trifluoromethyl)phenyl]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 307.3ºC at 760 mmHg |
| Molecular Formula | C8H7F3N2OS |
| Molecular Weight | 236.21400 |
| Flash Point | 139.7ºC |
| Exact Mass | 236.02300 |
| PSA | 94.91000 |
| LogP | 2.86020 |
| Vapour Pressure | 0.000402mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | KDIAXLMZUONVBM-UHFFFAOYSA-N |
| SMILES | NC(=S)Nc1cc(C(F)(F)F)ccc1O |
|
~%
[2-hydroxy-5-(t... CAS#:19420-46-3 |
| Literature: Sam; Valentine; Richmond Journal of pharmaceutical sciences, 1968 , vol. 57, # 10 p. 1763 - 1768 |
|
~%
[2-hydroxy-5-(t... CAS#:19420-46-3 |
| Literature: Sam; Valentine; Richmond Journal of pharmaceutical sciences, 1968 , vol. 57, # 10 p. 1763 - 1768 |
| 2-Hydroxy-5-trifluoromethylphenyl thiourea |
| 2-Hydroxy-5-trifluormethylphenylthioharnstoff |