2-[4-(azocan-1-yl)but-2-ynyl]isoindole-1,3-dione structure
|
Common Name | 2-[4-(azocan-1-yl)but-2-ynyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 19446-30-1 | Molecular Weight | 310.39000 | |
| Density | 1.169g/cm3 | Boiling Point | 462.5ºC at 760mmHg | |
| Molecular Formula | C19H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.2ºC | |
| Name | 2-[4-(azocan-1-yl)but-2-ynyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 462.5ºC at 760mmHg |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.39000 |
| Flash Point | 198.2ºC |
| Exact Mass | 310.16800 |
| PSA | 40.62000 |
| LogP | 2.42790 |
| Vapour Pressure | 9.8E-09mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | YLXJAIWUVMTROU-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CC#CCN1CCCCCCC1 |
| HS Code | 2933990090 |
|---|
|
~63%
2-[4-(azocan-1-... CAS#:19446-30-1 |
| Literature: Eldeen; Shubber; Musa; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 1 p. 85 - 88 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[4-(azocan-1-yl)but-2-yn-1-yl]-1h-isoindole-1,3(2h)-dione |
| Phthalimide,N-(4-(octahydroazocin-1-yl)but-2-ynyl) |
| N-(4-(Octahydroazocin-1-yl)but-2-ynyl)phthalimide |