2-[4-(azepan-1-yl)but-2-ynoxy]isoindole-1,3-dione structure
|
Common Name | 2-[4-(azepan-1-yl)but-2-ynoxy]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 74484-69-8 | Molecular Weight | 312.36300 | |
| Density | 1.27g/cm3 | Boiling Point | 466.1ºC at 760 mmHg | |
| Molecular Formula | C18H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.7ºC | |
| Name | 2-[4-(azepan-1-yl)but-2-ynoxy]isoindole-1,3-dione |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 466.1ºC at 760 mmHg |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.36300 |
| Flash Point | 235.7ºC |
| Exact Mass | 312.14700 |
| PSA | 49.85000 |
| LogP | 1.96940 |
| Index of Refraction | 1.619 |
| InChIKey | DWMJZELMNHSXAW-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1OCC#CCN1CCCCCC1 |
| HS Code | 2933990090 |
|---|
|
~49%
2-[4-(azepan-1-... CAS#:74484-69-8 |
| Literature: Eldeen; Shubber; Musa; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 1 p. 85 - 88 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |