1-oxopropane-1,2,3-tricarboxylic acid structure
|
Common Name | 1-oxopropane-1,2,3-tricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1948-82-9 | Molecular Weight | 190.10800 | |
| Density | 1.744g/cm3 | Boiling Point | 380.5ºC at 760mmHg | |
| Molecular Formula | C6H6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.1ºC | |
| Name | oxalosuccinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.744g/cm3 |
|---|---|
| Boiling Point | 380.5ºC at 760mmHg |
| Molecular Formula | C6H6O7 |
| Molecular Weight | 190.10800 |
| Flash Point | 198.1ºC |
| Exact Mass | 190.01100 |
| PSA | 128.97000 |
| Vapour Pressure | 7.68E-07mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | UFSCUAXLTRFIDC-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(C(=O)O)C(=O)C(=O)O |
| HS Code | 2918300090 |
|---|
|
~%
1-oxopropane-1,... CAS#:1948-82-9 |
|
Literature: Ochoa Journal of Biological Chemistry, 1945 , vol. 159, p. 243 Journal of Biological Chemistry, 1948 , vol. 174, p. 133 - 144 Full Text Show Details Krebs; Lowenstein in D. M. Greenberg Metabolic Pathways, Bd. 1 |
|
~%
1-oxopropane-1,... CAS#:1948-82-9 |
| Literature: Lynen; Scherer Justus Liebigs Annalen der Chemie, 1948 , vol. 560, p. 166,176 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Oxalylbernsteinsaeure |
| oxalosuccinate |
| Oxalbernsteinsaeure |
| 1-Oxo-propan-1,2,3-tricarbonsaeure |
| 1-oxopropane-1,2,3-tricarboxylic acid |
| Oxalosuccinicacid (6CI) |
| 2-Oxalosuccinic Acid |
| 1-oxo-propane-1,2,3-tricarboxylic acid |
| Oxalosuccinic acid |
| 1-oxopropane-1,2,3-tricarboxylate |