Bis(4-tertbutylphenyl)iodanium,1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate
Modify Date: 2025-08-25 18:24:16
Bis(4-tertbutylphenyl)iodanium,1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate structure
|
Common Name | Bis(4-tertbutylphenyl)iodanium,1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 194999-85-4 | Molecular Weight | 692.41700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H26F9IO3S | Melting Point | 175-177ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | bis(4-tert-butylphenyl)iodanium,1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 175-177ºC(lit.) |
|---|---|
| Molecular Formula | C24H26F9IO3S |
| Molecular Weight | 692.41700 |
| Exact Mass | 692.05000 |
| PSA | 65.58000 |
| LogP | 5.44810 |
| InChIKey | DJBAOXYQCAKLPH-UHFFFAOYSA-M |
| SMILES | CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| Bis(4-tert-butylphenyl)iodonium perfluoro-1-butanesulfonate |
| BIS(4-T-BUTYLPHENYL)IODONIUM PERFLUORO-1 |
| Bis[4-(1,1-dimethylethyl)phenyl]iodonium salt with 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonic acid (1:1) |
| MFCD02683473 |
| Bis(4-tertbutylphenyl)iodanium,1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |