N-(4-(Benzyloxy)phenyl)-2-chloroacetamide structure
|
Common Name | N-(4-(Benzyloxy)phenyl)-2-chloroacetamide | ||
|---|---|---|---|---|
| CAS Number | 19514-92-2 | Molecular Weight | 275.73000 | |
| Density | 1.261g/cm3 | Boiling Point | 478.5ºC at 760mmHg | |
| Molecular Formula | C15H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.2ºC | |
| Name | 2-chloro-N-(4-phenylmethoxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 478.5ºC at 760mmHg |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.73000 |
| Flash Point | 243.2ºC |
| Exact Mass | 275.07100 |
| PSA | 38.33000 |
| LogP | 3.51590 |
| Vapour Pressure | 2.56E-09mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | TUTQONMCEZLRPX-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1ccc(OCc2ccccc2)cc1 |
| Hazard Codes | C |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00791335 |