Fmoc-Ala-Ala-Asn(Trt)-OH structure
|
Common Name | Fmoc-Ala-Ala-Asn(Trt)-OH | ||
|---|---|---|---|---|
| CAS Number | 1951424-92-2 | Molecular Weight | 738.83 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H42N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-Ala-Ala-Asn(Trt)-OHFmoc-Ala-Ala-Asn(Trt)-OH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Fmoc-Ala-Ala-Asn(Trt)-OH |
|---|
| Description | Fmoc-Ala-Ala-Asn(Trt)-OH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C44H42N4O7 |
|---|---|
| Molecular Weight | 738.83 |
| InChIKey | PMEYZYXHXRXGHF-HXUMPODJSA-N |
| SMILES | CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC(C)C(=O)NC(CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |