Fmoc-PEG3-Ala-Ala-Asn(Trt)-PAB-PNP structure
|
Common Name | Fmoc-PEG3-Ala-Ala-Asn(Trt)-PAB-PNP | ||
|---|---|---|---|---|
| CAS Number | 2055042-82-3 | Molecular Weight | 1212.303 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1360.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C67H69N7O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 776.6±34.3 °C | |
Use of Fmoc-PEG3-Ala-Ala-Asn(Trt)-PAB-PNPFmoc-PEG3-Ala-Ala-Asn(Trt)-PAB-PNP is a peptide reagent for ADC conjugation that possesses a cleavable peptide sequence. The hydrophilic PEG spacer increases solubility in aqueous media. |
| Name | N-[1-(9H-Fluoren-9-yl)-3,16-dioxo-2,7,10,13-tetraoxa-4-azahexadecan-16-yl]-L-alanyl-L-alanyl-N1-[4-({[(4-nitrophenoxy)carbonyl]oxy}methyl)phenyl]-N4-trityl-L-aspartamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 1360.4±65.0 °C at 760 mmHg |
| Molecular Formula | C67H69N7O15 |
| Molecular Weight | 1212.303 |
| Flash Point | 776.6±34.3 °C |
| Exact Mass | 1211.485107 |
| LogP | 9.14 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | CWTALOCBQBLGIB-QLKUJSDXSA-N |
| SMILES | CC(NC(=O)CCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NC(C)C(=O)NC(CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| N-[1-(9H-Fluoren-9-yl)-3,16-dioxo-2,7,10,13-tetraoxa-4-azahexadecan-16-yl]-L-alanyl-L-alanyl-N1-[4-({[(4-nitrophenoxy)carbonyl]oxy}methyl)phenyl]-N4-trityl-L-aspartamide |
| L-Aspartamide, N-[16-(9H-fluoren-9-yl)-1,14-dioxo-4,7,10,15-tetraoxa-13-azahexadec-1-yl]-L-alanyl-L-alanyl-N1-[4-[[[(4-nitrophenoxy)carbonyl]oxy]methyl]phenyl]-N4-(triphenylmethyl)- |