Methanone,[4-(oxiranylmethoxy)phenyl]phenyl- structure
|
Common Name | Methanone,[4-(oxiranylmethoxy)phenyl]phenyl- | ||
|---|---|---|---|---|
| CAS Number | 19533-07-4 | Molecular Weight | 254.28100 | |
| Density | 1.2g/cm3 | Boiling Point | 415.5ºC at 760mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.8ºC | |
| Name | [4-(oxiran-2-ylmethoxy)phenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 415.5ºC at 760mmHg |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 196.8ºC |
| Exact Mass | 254.09400 |
| PSA | 38.83000 |
| LogP | 2.69520 |
| Vapour Pressure | 4.12E-07mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | LJRIZGQRKVWXSI-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(OCC2CO2)cc1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-glycidyloxy benzophenone |