Methanone,[4-[(4-nitrophenyl)thio]phenyl]phenyl- structure
|
Common Name | Methanone,[4-[(4-nitrophenyl)thio]phenyl]phenyl- | ||
|---|---|---|---|---|
| CAS Number | 6317-77-7 | Molecular Weight | 335.37600 | |
| Density | 1.34g/cm3 | Boiling Point | 541.1ºC at 760mmHg | |
| Molecular Formula | C19H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281ºC | |
| Name | [4-(4-nitrophenyl)sulfanylphenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 541.1ºC at 760mmHg |
| Molecular Formula | C19H13NO3S |
| Molecular Weight | 335.37600 |
| Flash Point | 281ºC |
| Exact Mass | 335.06200 |
| PSA | 88.19000 |
| LogP | 5.50020 |
| Index of Refraction | 1.689 |
| InChIKey | BJZZAZZTFGDVAW-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
Methanone,[4-[(... CAS#:6317-77-7 |
| Literature: Szmant; Irwin Journal of the American Chemical Society, 1956 , vol. 78, p. 4386,4388 |
|
~%
Methanone,[4-[(... CAS#:6317-77-7 |
| Literature: Dilthey et al. Journal fuer Praktische Chemie (Leipzig), 1931 , vol. <2>129, p. 189,200 |
| hms2750e13 |