methyl 3-(chlorocarbonyl)-5-nitrobenzoate structure
|
Common Name | methyl 3-(chlorocarbonyl)-5-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 1955-04-0 | Molecular Weight | 243.60100 | |
| Density | 1.471g/cm3 | Boiling Point | 369.8ºC at 760mmHg | |
| Molecular Formula | C9H6ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.5ºC | |
| Name | methyl 3-carbonochloridoyl-5-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.471g/cm3 |
|---|---|
| Boiling Point | 369.8ºC at 760mmHg |
| Molecular Formula | C9H6ClNO5 |
| Molecular Weight | 243.60100 |
| Flash Point | 177.5ºC |
| Exact Mass | 242.99300 |
| PSA | 89.19000 |
| LogP | 2.28360 |
| Vapour Pressure | 1.15E-05mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | DQTOZIJNMYYCJE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(=O)Cl)cc([N+](=O)[O-])c1 |
|
~96%
methyl 3-(chlor... CAS#:1955-04-0 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH; BIOLIPOX AB Patent: WO2008/71944 A1, 2008 ; Location in patent: Page/Page column 56; 62 ; |
|
~%
methyl 3-(chlor... CAS#:1955-04-0 |
| Literature: Kahnberg, Pia; Lager, Erik; Rosenberg, Celia; Schougaard, Jette; Camet, Linda; Sterner, Olov; Nielsen, Elsebet stergaard; Nielsen, Mogens; Liljefors, Tommy Journal of Medicinal Chemistry, 2002 , vol. 45, # 19 p. 4188 - 4201 |
| methyl 5-nitro-3-chloroformylbenzoate |
| 3-nitro-5-methoxycarbonyl-benzoylchloride |
| methyl 3-(chlorocarbonyl)-5-nitrobenzoate |
| EINECS 217-789-4 |
| 3-carbomethoxy-5-nitrobenzoyl chloride |
| 3-methoxycarbonyl-5-nitro-benzoic acid chloride |
| 3-chlorocarbonyl-5-nitrobenzoic acid methyl ester |
| 3-methoxycarbonyl-5-nitrobenzoyl chloride |