5-Nitroisophthalic acid structure
|
Common Name | 5-Nitroisophthalic acid | ||
|---|---|---|---|---|
| CAS Number | 618-88-2 | Molecular Weight | 211.128 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 473.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H5NO6 | Melting Point | 259-261 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 213.9±15.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Nitroisophthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 473.7±40.0 °C at 760 mmHg |
| Melting Point | 259-261 °C(lit.) |
| Molecular Formula | C8H5NO6 |
| Molecular Weight | 211.128 |
| Flash Point | 213.9±15.8 °C |
| Exact Mass | 211.011688 |
| PSA | 120.42000 |
| LogP | 1.79 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.660 |
| InChIKey | NBDAHKQJXVLAID-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(=O)O)cc([N+](=O)[O-])c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Class | 6.1 |
| HS Code | 2917399090 |
|
~73%
5-Nitroisophtha... CAS#:618-88-2 |
| Literature: Thiel, W.; Mayer, R.; Jauer, E.-A.; Modrow, H.; Dost, H. Journal fuer Praktische Chemie (Leipzig), 1986 , vol. 328, # 4 p. 497 - 514 |
|
~%
5-Nitroisophtha... CAS#:618-88-2 |
| Literature: Hidefumi Hirai Patent: US5319134 A1, 1994 ; |
|
~%
5-Nitroisophtha... CAS#:618-88-2 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 27, p. 277 Journal fuer Praktische Chemie (Leipzig), , vol. <2> 38, p. 313 |
|
~%
5-Nitroisophtha... CAS#:618-88-2 |
| Literature: Chemische Berichte, , vol. 15, p. 1022 |
|
~%
5-Nitroisophtha... CAS#:618-88-2 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 27, p. 277 |
|
~%
5-Nitroisophtha... CAS#:618-88-2 |
| Literature: Chemische Berichte, , vol. 42, p. 433 |
|
~%
5-Nitroisophtha... CAS#:618-88-2 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 27, p. 277 Journal fuer Praktische Chemie (Leipzig), , vol. <2> 38, p. 313 Journal fuer Praktische Chemie (Leipzig), , vol. <2> 22, p. 352 Journal fuer Praktische Chemie (Leipzig), , vol. <2> 25, p. 470 Justus Liebigs Annalen der Chemie, , vol. 153, p. 285 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5-nitro-1,3-benzenedicarboxylate |
| 1,3-Benzenedicarboxylic acid, 5-nitro- |
| 5-nitro-1,3-benzenedicarboxylic acid |
| EINECS 210-568-3 |
| 5itroIsophathalicAcid |
| 5-NIPA |
| 3-Carboxy-5-nitrobenzoic acid |
| 5-NO2-isophthalic acid |
| 5-Nitro-m-phthalic acid |
| 5-nitrobenzene-1,3-dicarboxylic acid |
| 5-Nitroisophthalic acid |
| 5-Nitroisophthalic a |
| NITRO ISOPHTHALIC ACID |
| NITROISOPHTHALIC-5 ACID |
| MFCD00007254 |
| 5-Nitroisophthalicacid |