diethyl 2-(1,3-dithiolan-2-ylidene)propanedioate structure
|
Common Name | diethyl 2-(1,3-dithiolan-2-ylidene)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 19607-41-1 | Molecular Weight | 262.34600 | |
| Density | 1.295g/cm3 | Boiling Point | 334.1ºC at 760 mmHg | |
| Molecular Formula | C10H14O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.2ºC | |
| Name | diethyl 2-(1,3-dithiolan-2-ylidene)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.295g/cm3 |
|---|---|
| Boiling Point | 334.1ºC at 760 mmHg |
| Molecular Formula | C10H14O4S2 |
| Molecular Weight | 262.34600 |
| Flash Point | 153.2ºC |
| Exact Mass | 262.03300 |
| PSA | 103.20000 |
| LogP | 1.80420 |
| Vapour Pressure | 0.000131mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | JCKRRRSDPZOMBF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)=C1SCCS1 |
|
~89%
diethyl 2-(1,3-... CAS#:19607-41-1 |
| Literature: Ouyang, Yan; Dong, Dewen; Yu, Haifeng; Liang, Yongjiu; Liu, Qun Advanced Synthesis and Catalysis, 2006 , vol. 348, # 1-2 p. 206 - 210 |
|
~%
diethyl 2-(1,3-... CAS#:19607-41-1 |
| Literature: Ilford Ltd. Patent: US2493071 , 1946 ; |
| [1,3]dithiolan-2-ylidene-malonic acid diethyl ester |
| [1,3]Dithiolan-2-yliden-malonsaeure-diaethylester |