3-(BICYCLO[2.2.1]HEPT-5-EN-2-YL)-1,1,1-TRIFLUORO-2-(TRIFLUOROMETHYL)PROPAN-2-OL structure
|
Common Name | 3-(BICYCLO[2.2.1]HEPT-5-EN-2-YL)-1,1,1-TRIFLUORO-2-(TRIFLUOROMETHYL)PROPAN-2-OL | ||
|---|---|---|---|---|
| CAS Number | 196314-61-1 | Molecular Weight | 274.20300 | |
| Density | 1.374g/cm3 | Boiling Point | 261.7ºC at 760mmHg | |
| Molecular Formula | C11H12F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.1ºC | |
| Name | 2-(5-bicyclo[2.2.1]hept-2-enylmethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 261.7ºC at 760mmHg |
| Molecular Formula | C11H12F6O |
| Molecular Weight | 274.20300 |
| Flash Point | 112.1ºC |
| Exact Mass | 274.07900 |
| PSA | 20.23000 |
| LogP | 3.44440 |
| Vapour Pressure | 0.00162mmHg at 25°C |
| Index of Refraction | 1.424 |
| InChIKey | NIQLOLNJWXWZHX-UHFFFAOYSA-N |
| SMILES | OC(CC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2906199090 |
|
~%
3-(BICYCLO[2.2.... CAS#:196314-61-1 |
| Literature: Journal of Fluorine Chemistry, , vol. 125, # 11 SPEC. ISS. p. 1791 - 1799 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906199090 |
|---|---|
| Summary | 2906199090. cyclanic, cyclenic or cyclotherpenic alcohols. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |