Benzaldehyde,2,3,4,5,6-pentachloro- structure
|
Common Name | Benzaldehyde,2,3,4,5,6-pentachloro- | ||
|---|---|---|---|---|
| CAS Number | 19635-52-0 | Molecular Weight | 278.34700 | |
| Density | 1.73g/cm3 | Boiling Point | 328.8ºC at 760mmHg | |
| Molecular Formula | C7HCl5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.5ºC | |
| Name | 2,3,4,5,6-pentachlorobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 328.8ºC at 760mmHg |
| Molecular Formula | C7HCl5O |
| Molecular Weight | 278.34700 |
| Flash Point | 138.5ºC |
| Exact Mass | 275.84700 |
| PSA | 17.07000 |
| LogP | 4.76610 |
| Vapour Pressure | 0.000186mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | XFFTWZZGUGZURK-UHFFFAOYSA-N |
| SMILES | O=Cc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2913000090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Pentachlorobenzaldehyde |
| Benzaldehyde,pentachloro |
| Pentachlor-benzaldehyd |