siegesmethyethericacid structure
|
Common Name | siegesmethyethericacid | ||
|---|---|---|---|---|
| CAS Number | 196399-16-3 | Molecular Weight | 334.493 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 448.1±18.0 °C at 760 mmHg | |
| Molecular Formula | C21H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.9±14.7 °C | |
Use of siegesmethyethericacidSiegesmethyletheric acid is isolated from the ethyl acetate fraction of Siegesbeckia orientalis L. (Asteraceae)[1]. |
| Name | siegesmethyethericacid |
|---|---|
| Synonym | More Synonyms |
| Description | Siegesmethyletheric acid is isolated from the ethyl acetate fraction of Siegesbeckia orientalis L. (Asteraceae)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 448.1±18.0 °C at 760 mmHg |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.493 |
| Flash Point | 149.9±14.7 °C |
| Exact Mass | 334.250793 |
| LogP | 5.40 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | ZJWVIZJOTTXJSA-UHFFFAOYSA-N |
| SMILES | COCC1CC23CCC4C(C)(C(=O)O)CCCC4(C)C2CCC1C3 |
| Hazard Codes | Xi |
|---|
| (5β,8α,9β,10α,13α,16ξ)-17-Methoxykauran-18-oic acid |