3,8-diaminonaphthalene-1,5-disulphonic acid structure
|
Common Name | 3,8-diaminonaphthalene-1,5-disulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 19659-81-5 | Molecular Weight | 318.32600 | |
| Density | 1.833g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,8-diaminonaphthalene-1,5-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.833g/cm3 |
|---|---|
| Molecular Formula | C10H10N2O6S2 |
| Molecular Weight | 318.32600 |
| Exact Mass | 317.99800 |
| PSA | 177.54000 |
| LogP | 3.82160 |
| Index of Refraction | 1.771 |
| InChIKey | IQCQWQDFHQPFIT-UHFFFAOYSA-N |
| SMILES | Nc1cc(S(=O)(=O)O)c2c(N)ccc(S(=O)(=O)O)c2c1 |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,6-diamino-naphthalene-4,8-disulphonic acid |
| EINECS 243-207-3 |
| 3,8-diamino-naphthalene-1,5-disulfonic acid |
| 1,6-diaminonaphthalene-4,8-disulfonic acid |
| Naphthylen-diamin-(1.6)-disulfonsaeure-(4.8) |
| 2,5-diamino-4,8-disulpho-naphthalene |
| 3,8-Diaminonaphthalene-1,5-disulphonic acid |
| 3,8-Diamino-naphthalin-1,5-disulfonsaeure |
| 1,6-Diamino-4,8-naphthalenedisulfonicacid |