Oseltamivir structure
|
Common Name | Oseltamivir | ||
|---|---|---|---|---|
| CAS Number | 196618-13-0 | Molecular Weight | 312.40 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 445.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H28N2O4 | Melting Point | 109 °C | |
| MSDS | N/A | Flash Point | 223.2±31.5 °C | |
Use of OseltamivirOseltamivir (GS 4104) is an orally active influenza virus neuraminidase inhibitor (NAI). Oseltamivir inhibits influenza A/H3N2, A/H1N2, A/H1N1, and B viruses with mean IC50s of 0.67, 0.9, 1.34 and 13 nM, respectively[1]. |
| Name | oseltamivir |
|---|---|
| Synonym | More Synonyms |
| Description | Oseltamivir (GS 4104) is an orally active influenza virus neuraminidase inhibitor (NAI). Oseltamivir inhibits influenza A/H3N2, A/H1N2, A/H1N1, and B viruses with mean IC50s of 0.67, 0.9, 1.34 and 13 nM, respectively[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.4±55.0 °C at 760 mmHg |
| Melting Point | 109 °C |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.40 |
| Flash Point | 223.2±31.5 °C |
| Exact Mass | 312.204895 |
| PSA | 90.65000 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | VSZGPKBBMSAYNT-RRFJBIMHSA-N |
| SMILES | CCOC(=O)C1=CC(OC(CC)CC)C(NC(C)=O)C(N)C1 |
| OSELTAMIVIR |
| (3R,4R,5S)-4-acetamido-5-amino-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylic acid ethyl ester |
| Oseltamivir (free base) |
| TaMvir |
| GOP-A-Flu |
| (3R,5S)-ethyl 4-acetamido-5-amino-3-(pentan-3-yloxy)cyclohex-1-enecarboxylate |
| TaMiflu-Free |
| TAMIFLU |
| (3R,4R,5S)-4-acetylamino-5-amino-3(1-ethylpropoxy)-1-cyclohexene-1-carboxylic acid ethyl ester |
| OSTELTAMIVIR |
| (3R,4R,5S)-5-amino-4-acetylamino-3-(1-ethyl-propoxy)-cyclohex-1-ene-carboxylic acid ethyl ester |
| GS 4104 |
| ethyl (3R,4R,5S)-5-aMino-4-acetaMido-3-(pentan-3-yloxy)cyclohex-1-ene-1-carboxylate |
| [14C]-Oseltamivir |
| ethyl (3R,4R,5S)-4-acetamido-5-amino-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylate |