Murrayone structure
|
Common Name | Murrayone | ||
|---|---|---|---|---|
| CAS Number | 19668-69-0 | Molecular Weight | 258.269 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 452.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O4 | Melting Point | 130℃ | |
| MSDS | N/A | Flash Point | 203.4±28.8 °C | |
Use of MurrayoneMurrayone, a coumarin-containing compound extracted from M. paniculata, is the most bioactive substance in this species and is a cancer metastasis chemopreventive agent based on its unique pharmacological properties[1]. |
| Name | 7-methoxy-8-(3-methyl-2-oxobut-3-enyl)chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Murrayone, a coumarin-containing compound extracted from M. paniculata, is the most bioactive substance in this species and is a cancer metastasis chemopreventive agent based on its unique pharmacological properties[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 452.8±45.0 °C at 760 mmHg |
| Melting Point | 130℃ |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.269 |
| Flash Point | 203.4±28.8 °C |
| Exact Mass | 258.089203 |
| PSA | 56.51000 |
| LogP | 1.93 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | IISMOXLSZASLDD-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)Cc1c(OC)ccc2ccc(=O)oc12 |
| HS Code | 2932209090 |
|---|
|
~%
Murrayone CAS#:19668-69-0 |
| Literature: Phytochemistry (Elsevier), , vol. 22, # 3 p. 792 - 794 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-Methoxy-8-(3-methyl-2-oxobut-3-en-1-yl)-2H-chromen-2-one |
| 7-methoxy-8-(3-methyl-2-oxo-but-3-enyl)-chromen-2-one |
| 2H-1-Benzopyran-2-one, 7-methoxy-8-(3-methyl-2-oxo-3-buten-1-yl)- |
| 7-Methoxy-8-(3-methyl-2-oxo-3-buten-1-yl)-2H-chromen-2-one |
| Murrayone |