Auraptenol structure
|
Common Name | Auraptenol | ||
|---|---|---|---|---|
| CAS Number | 1221-43-8 | Molecular Weight | 260.29 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 446.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.0±22.2 °C | |
Use of AuraptenolAuraptenol is a coumarin that can be isolated from the leaves of Murraya paniculata[1]. |
| Name | Auraptenol |
|---|---|
| Synonym | More Synonyms |
| Description | Auraptenol is a coumarin that can be isolated from the leaves of Murraya paniculata[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 446.7±45.0 °C at 760 mmHg |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 |
| Flash Point | 168.0±22.2 °C |
| Exact Mass | 260.104858 |
| PSA | 59.67000 |
| LogP | 2.23 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | SQSRYWNOKPJENY-LBPRGKRZSA-N |
| SMILES | C=C(C)C(O)Cc1c(OC)ccc2ccc(=O)oc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932209090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2H-1-Benzopyran-2-one, 8-(2-hydroxy-3-methyl-3-buten-1-yl)-7-methoxy- |
| 8-(2-hydroxy-3-methylbut-3-en-1-yl)-7-methoxy-2H-chromen-2-one |
| 8-(2-Hydroxy-3-methyl-3-buten-1-yl)-7-methoxy-2H-chromen-2-one |
| 2H-1-Benzopyran-2-one, 8-[(2S)-2-hydroxy-3-methyl-3-buten-1-yl]-7-methoxy- |
| 8-[(2S)-2-Hydroxy-3-methyl-3-buten-1-yl]-7-methoxy-2H-chromen-2-one |