4-(DiphenylhydroxyMethyl)benzoic acid structure
|
Common Name | 4-(DiphenylhydroxyMethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 19672-49-2 | Molecular Weight | 304.339 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 511.2±38.0 °C at 760 mmHg | |
| Molecular Formula | C20H16O3 | Melting Point | 210-215ºC | |
| MSDS | Chinese USA | Flash Point | 277.1±23.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-[hydroxy(diphenyl)methyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 511.2±38.0 °C at 760 mmHg |
| Melting Point | 210-215ºC |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.339 |
| Flash Point | 277.1±23.3 °C |
| Exact Mass | 304.109955 |
| PSA | 57.53000 |
| LogP | 4.26 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | CPZWBWPALJLUBJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(O)(c2ccccc2)c2ccccc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918199090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
B. Henkel et al.
Liebigs Ann./Recueil , 2161, (1997)
|
| 4-[Hydroxy(diphenyl)methyl]benzoic acid |
| MFCD01851481 |
| Benzoic acid, 4-(hydroxydiphenylmethyl)- |
| 4-(hydroxy(diphenyl)methyl)benzoic acid |
| 4-(Diphenylhydroxymethyl)benzoic acid |
| Triphenylcarbinol-carbonsaeure-(4) |