Molybdenum,bis(N,N-diethylcarbamodithioato-kS,kS')dioxo-, (OC-6-21)- structure
|
Common Name | Molybdenum,bis(N,N-diethylcarbamodithioato-kS,kS')dioxo-, (OC-6-21)- | ||
|---|---|---|---|---|
| CAS Number | 19680-83-2 | Molecular Weight | 424.49800 | |
| Density | N/A | Boiling Point | 176.4ºC at 760 mmHg | |
| Molecular Formula | C10H20MoN2O2S4 | Melting Point | 103ºC (dec.) | |
| MSDS | N/A | Flash Point | 60.5ºC | |
| Name | bis(diethyldithiocarbamato)dioxomolybdenum(vi) |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 176.4ºC at 760 mmHg |
|---|---|
| Melting Point | 103ºC (dec.) |
| Molecular Formula | C10H20MoN2O2S4 |
| Molecular Weight | 424.49800 |
| Flash Point | 60.5ºC |
| Exact Mass | 425.94600 |
| PSA | 155.40000 |
| LogP | 3.38360 |
| Vapour Pressure | 1.1mmHg at 25°C |
| InChIKey | VEIIJBMUSYIGRD-UHFFFAOYSA-L |
| SMILES | CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].O=[Mo+2]=O |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39-36 |
|
~65%
Molybdenum,bis(... CAS#:19680-83-2 |
| Literature: Arzoumanian, Henri; Krentzien, Heinz; Corao, Carolina; Lopez, Rafael; Agrifoglio, Giuseppe Polyhedron, 1995 , vol. 14, p. 2887 - 2892 |
|
~%
Molybdenum,bis(... CAS#:19680-83-2 |
| Literature: Elliott, Robyn L.; Nichols, Peter J.; West, Bruce O. Australian Journal of Chemistry, 1986 , vol. 39, p. 975 - 986 |
|
~%
Molybdenum,bis(... CAS#:19680-83-2 |
| Literature: Elliott, Robyn L.; Nichols, Peter J.; West, Bruce O. Australian Journal of Chemistry, 1986 , vol. 39, p. 975 - 986 |
| Molybdenum diethyldithiocarbamate oxide |
| Mo(O)2(Et2-dithiocarbamate)2 |
| bis(N,N-diethyldithiocarbamato)dioxomolybdenum(VI) |
| Molybdenum,bis(diethylcarbamodithioato-S,S')dioxo |
| bis(N,N-diethyldithiocarbamate)dioxomolybdenum(VI) |
| bis(diethylcarbamodithioato-S,S')dioxomolybdenum |
| MOLYBDENYL DIETHYLDITHIOCARBAMATE |
| MoO2[S2CNEt2]2 |
| dioxobis(N,N-diethyldithiocarbamato)molybdenum |
| dioxo-bis-diethyldithiocarbamato molybdenum(VI) |