tert-Butyl 4-carbamothioylpiperazine-1-carboxylate structure
|
Common Name | tert-Butyl 4-carbamothioylpiperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 196811-66-2 | Molecular Weight | 245.342 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 354.7±52.0 °C at 760 mmHg | |
| Molecular Formula | C10H19N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.3±30.7 °C | |
| Name | tert-butyl 4-carbamothioylpiperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.7±52.0 °C at 760 mmHg |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.342 |
| Flash Point | 168.3±30.7 °C |
| Exact Mass | 245.119797 |
| PSA | 90.89000 |
| LogP | 0.35 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | JBKRAGACGOPWFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(N)=S)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~73%
tert-Butyl 4-ca... CAS#:196811-66-2 |
| Literature: NV reMYND Patent: US2010/197703 A1, 2010 ; Location in patent: Page/Page column 77 ; |
|
~%
tert-Butyl 4-ca... CAS#:196811-66-2 |
| Literature: WO2005/66180 A1, ; Page/Page column 71 ; WO 2005/066180 A1 |
|
~%
tert-Butyl 4-ca... CAS#:196811-66-2 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 16, # 16 p. 4296 - 4299 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,1-dimethylethyl 4-(aminothioxomethyl)-1-piperazinecarboxylate |
| tert-butyl 4-thiocarbamoyl-1-piperazinecarboxylate |
| 1-Piperazinecarboxylic acid, 4-(aminothioxomethyl)-, 1,1-dimethylethyl ester |
| 1-Boc-4-Carbamothioylpiperazine |
| 1,1-dimethylethyl 4-(aminocarbonothioyl)-1-piperazinecarboxylate |
| tert-butyl 4-carbamothioylpiperazine-1-carboxylate |
| 4-thionocarbonylpiperazine-1-carboxylic acid tert-butyl ester |
| 2-Methyl-2-propanyl 4-carbamothioyl-1-piperazinecarboxylate |
| 4-(tert-Butoxycarbonyl)piperazine-1-thiocarboxamide |
| 4-(Tert-butoxycarbonyl)piperazine-1-thicarboxamide |
| 4-Thiocarbamoyl-piperazine-1-carboxylic acid tert-butyl ester |