Cyclohexanecarboxylicacid, 2-[(2-thiazolylamino)carbonyl]- structure
|
Common Name | Cyclohexanecarboxylicacid, 2-[(2-thiazolylamino)carbonyl]- | ||
|---|---|---|---|---|
| CAS Number | 19692-01-4 | Molecular Weight | 254.30500 | |
| Density | 1.412g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,3-thiazol-2-ylcarbamoyl)cyclohexane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412g/cm3 |
|---|---|
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.30500 |
| Exact Mass | 254.07300 |
| PSA | 107.53000 |
| LogP | 2.04560 |
| Index of Refraction | 1.629 |
| InChIKey | WXZWNOAGMLCICB-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CCCCC1C(=O)Nc1nccs1 |
| HS Code | 2934100090 |
|---|
|
~%
Cyclohexanecarb... CAS#:19692-01-4 |
| Literature: Rice,L.M. et al. Journal of Medicinal Chemistry, 1968 , vol. 11, # 1 p. 183 - 185 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-<Thiazolyl-(2)>-1-carboxy-cyclohexan-2-carbonsaeureamid |
| 2-thiazol-2-ylcarbamoyl-cyclohexanecarboxylic acid |
| 2-(1,3-thiazol-2-ylcarbamoyl)cyclohexanecarboxylic acid |
| cyclohexanecarboxylic acid,2-[(2-thiazolylamino)carbonyl] |